C16H22N2O5 — CID 7568691
(2-amino-2-oxoethyl) (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 7568691) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2-amino-2-oxoethyl) (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7568691 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2-amino-2-oxoethyl) (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccccc1C(=O)N[C@H](C(=O)OCC(N)=O)C(C)C |
| InChI | InChI=1S/C16H22N2O5/c1-4-22-12-8-6-5-7-11(12)15(20)18-14(10(2)3)16(21)23-9-13(17)19/h5-8,10,14H,4,9H2,1-3H3,(H2,17,19)(H,18,20)/t14-/m0/s1 |
| InChIKey | XQTNKNZVMGRWPN-AWEZNQCLSA-N |
| XLogP | 0.87 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |