C13H16N2O5 — CID 30120326
(2S)-4-amino-2-[(2-ethoxybenzoyl)amino]-4-oxobutanoic acid (PubChem CID 30120326) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-4-amino-2-[(2-ethoxybenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(2-ethoxybenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 30120326 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-4-amino-2-[(2-ethoxybenzoyl)amino]-4-oxobutanoic acid |
| SMILES | CCOc1ccccc1C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c1-2-20-10-6-4-3-5-8(10)12(17)15-9(13(18)19)7-11(14)16/h3-6,9H,2,7H2,1H3,(H2,14,16)(H,15,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | ISXMYUNHQNOHMA-VIFPVBQESA-N |
| XLogP | 0.14 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |