C20H20Cl2FNO4 — CID 18230809
2-(2-fluorophenoxy)ethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 18230809) has the molecular formula C20H20Cl2FNO4 and a molecular weight of 428.29 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 18230809 |
| Molecular Formula | C20H20Cl2FNO4 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)OCCOc1ccccc1F |
| InChI | InChI=1S/C20H20Cl2FNO4/c1-12(2)18(24-19(25)14-8-7-13(21)11-15(14)22)20(26)28-10-9-27-17-6-4-3-5-16(17)23/h3-8,11-12,18H,9-10H2,1-2H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | VVNZVDCKANAPKQ-SFHVURJKSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|