C18H16Cl2FNO3 — CID 8927547
(2,5-dichlorophenyl) (2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 8927547) has the molecular formula C18H16Cl2FNO3 and a molecular weight of 384.23 g/mol. Its IUPAC name is (2,5-dichlorophenyl) (2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2,5-dichlorophenyl) (2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8927547 |
| Molecular Formula | C18H16Cl2FNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (2,5-dichlorophenyl) (2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2FNO3/c1-10(2)16(22-17(23)12-5-3-4-6-14(12)21)18(24)25-15-9-11(19)7-8-13(15)20/h3-10,16H,1-2H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | KWMUOQNQXCNGLF-INIZCTEOSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|