C23H23Cl2NO6 — CID 43046863
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 43046863) has the molecular formula C23H23Cl2NO6 and a molecular weight of 480.34 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43046863 |
| Molecular Formula | C23H23Cl2NO6 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C23H23Cl2NO6/c1-13(2)21(26-22(28)16-8-7-15(24)12-17(16)25)23(29)32-18-9-5-14(11-19(18)30-3)6-10-20(27)31-4/h5-13,21H,1-4H3,(H,26,28)/b10-6+ |
| InChIKey | HXQOSJDBNJOMDO-UXBLZVDNSA-N |
| XLogP | 4.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|