C18H17ClF2N2O2 — CID 8928056
N-[(2S)-1-(5-chloro-2-fluoroanilino)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 8928056) has the molecular formula C18H17ClF2N2O2 and a molecular weight of 366.80 g/mol. Its IUPAC name is N-[(2S)-1-(5-chloro-2-fluoroanilino)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(2S)-1-(5-chloro-2-fluoroanilino)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 8928056 |
| Molecular Formula | C18H17ClF2N2O2 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[(2S)-1-(5-chloro-2-fluoroanilino)-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C18H17ClF2N2O2/c1-10(2)16(23-17(24)12-5-3-4-6-13(12)20)18(25)22-15-9-11(19)7-8-14(15)21/h3-10,16H,1-2H3,(H,22,25)(H,23,24)/t16-/m0/s1 |
| InChIKey | BUGXGTYQBOUDEO-INIZCTEOSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |