C20H23Cl2N3O2 — CID 112764584
2-chloro-N-[1-[5-chloro-2-(dimethylamino)anilino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 112764584) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 2-chloro-N-[1-[5-chloro-2-(dimethylamino)anilino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[5-chloro-2-(dimethylamino)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 112764584 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-chloro-N-[1-[5-chloro-2-(dimethylamino)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)Nc1cc(Cl)ccc1N(C)C |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-12(2)18(24-19(26)14-7-5-6-8-15(14)22)20(27)23-16-11-13(21)9-10-17(16)25(3)4/h5-12,18H,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | WPQDEWPBJPADBK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |