C13H15ClFNO3 — CID 43408111
methyl 2-[(4-chloro-2-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 43408111) has the molecular formula C13H15ClFNO3 and a molecular weight of 287.72 g/mol. Its IUPAC name is methyl 2-[(4-chloro-2-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(4-chloro-2-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43408111 |
| Molecular Formula | C13H15ClFNO3 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | methyl 2-[(4-chloro-2-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(Cl)cc1F)C(C)C |
| InChI | InChI=1S/C13H15ClFNO3/c1-7(2)11(13(18)19-3)16-12(17)9-5-4-8(14)6-10(9)15/h4-7,11H,1-3H3,(H,16,17) |
| InChIKey | VHXQNDDACMQGNN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |