C30H32ClN3O5S2 — CID 133244717
4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]benzamide (PubChem CID 133244717) has the molecular formula C30H32ClN3O5S2 and a molecular weight of 614.19 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]benzamide.
| Compound Name | 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 133244717 |
| Molecular Formula | C30H32ClN3O5S2 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]benzamide |
| SMILES | O=C(NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(C2SCC(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H32ClN3O5S2/c31-25-10-4-22(5-11-25)20-34-28(35)21-40-30(34)24-8-6-23(7-9-24)29(36)32-16-19-39-26-12-14-27(15-13-26)41(37,38)33-17-2-1-3-18-33/h4-15,30H,1-3,16-21H2,(H,32,36) |
| InChIKey | QITPNEPYAHDZDJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|