C26H25ClN2O3S — CID 133164093
4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-(2-phenylmethoxyethyl)benzamide (PubChem CID 133164093) has the molecular formula C26H25ClN2O3S and a molecular weight of 481.02 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-(2-phenylmethoxyethyl)benzamide.
| Compound Name | 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-(2-phenylmethoxyethyl)benzamide |
|---|---|
| PubChem CID | 133164093 |
| Molecular Formula | C26H25ClN2O3S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]-N-(2-phenylmethoxyethyl)benzamide |
| SMILES | O=C(NCCOCc1ccccc1)c1ccc(C2SCC(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O3S/c27-23-12-6-19(7-13-23)16-29-24(30)18-33-26(29)22-10-8-21(9-11-22)25(31)28-14-15-32-17-20-4-2-1-3-5-20/h1-13,26H,14-18H2,(H,28,31) |
| InChIKey | SBJVZJAAXRSVEZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|