C29H31ClN2O3S — CID 133252163
N-[2-(2-tert-butylphenoxy)ethyl]-4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 133252163) has the molecular formula C29H31ClN2O3S and a molecular weight of 523.10 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)ethyl]-4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[2-(2-tert-butylphenoxy)ethyl]-4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 133252163 |
| Molecular Formula | C29H31ClN2O3S |
| Molecular Weight | 523.10 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)ethyl]-4-[3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccccc1OCCNC(=O)c1ccc(C2SCC(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H31ClN2O3S/c1-29(2,3)24-6-4-5-7-25(24)35-17-16-31-27(34)21-10-12-22(13-11-21)28-32(26(33)19-36-28)18-20-8-14-23(30)15-9-20/h4-15,28H,16-19H2,1-3H3,(H,31,34) |
| InChIKey | GUNXBQFMQLCHGR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.10 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|