About 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide (PubChem CID 133252142) has the molecular formula C29H32N2O3S
and a molecular weight of 488.65 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide.
Molecular Properties
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide |
| PubChem CID | 133252142 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide |
| SMILES | CC(C)(C)c1ccccc1OCCNC(=O)c1ccc(C2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O3S/c1-29(2,3)24-11-7-8-12-25(24)34-18-17-30-27(33)22-13-15-23(16-14-22)28-31(26(32)20-35-28)19-21-9-5-4-6-10-21/h4-16,28H,17-20H2,1-3H3,(H,30,33) |
| InChIKey | YOHDMRWTQOANCK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide?
The IUPAC name of 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide (CID 133252142) is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide.
What is the SMILES notation for 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide?
The canonical SMILES for 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide is CC(C)(C)c1ccccc1OCCNC(=O)c1ccc(C2SCC(=O)N2Cc2ccccc2)cc1.
What is the InChIKey of 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide?
The InChIKey is YOHDMRWTQOANCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32N2O3S/c1-29(2,3)24-11-7-8-12-25(24)34-18-17-30-27(33)22-13-15-23(16-14-22)28-31(26(32)20-35-28)19-21-9-5-4-6-10-21/h4-16,28H,17-20H2,1-3H3,(H,30,33).
What are the key properties of 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide?
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide has a molecular weight of 488.65 g/mol, XLogP of 5.57, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[2-(2-tert-butylphenoxy)ethyl]benzamide is sourced from PubChem (CID 133252142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).