C18H20N2OS2 — CID 35941522
4-(1,3-dithian-2-yl)-N-[(1R)-1-pyridin-2-ylethyl]benzamide (PubChem CID 35941522) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-[(1R)-1-pyridin-2-ylethyl]benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-[(1R)-1-pyridin-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 35941522 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-[(1R)-1-pyridin-2-ylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(C2SCCCS2)cc1)c1ccccn1 |
| InChI | InChI=1S/C18H20N2OS2/c1-13(16-5-2-3-10-19-16)20-17(21)14-6-8-15(9-7-14)18-22-11-4-12-23-18/h2-3,5-10,13,18H,4,11-12H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | DAQYWJBWNNZCID-CYBMUJFWSA-N |
| XLogP | 4.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |