C25H25N3O5S — CID 24683129
N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 24683129) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24683129 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)NCc3ccc(NC(=O)C4CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-33-22-12-10-21(11-13-22)28-34(31,32)23-14-6-18(7-15-23)24(29)26-16-17-2-8-20(9-3-17)27-25(30)19-4-5-19/h2-3,6-15,19,28H,4-5,16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | JVTLENXMBMLUML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |