C20H20N2O3 — CID 78811024
N-[4-(cyanomethyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 78811024) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 78811024 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | N#CCc1ccc(NC(=O)c2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c21-12-11-15-3-7-17(8-4-15)22-20(23)16-5-9-18(10-6-16)25-14-19-2-1-13-24-19/h3-10,19H,1-2,11,13-14H2,(H,22,23) |
| InChIKey | HMLCCTNTFZFUFD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |