C15H12ClNO3 — CID 43386540
4-[(5-chloro-2-methylphenyl)carbamoyl]benzoic acid (PubChem CID 43386540) has the molecular formula C15H12ClNO3 and a molecular weight of 289.72 g/mol. Its IUPAC name is 4-[(5-chloro-2-methylphenyl)carbamoyl]benzoic acid.
| Compound Name | 4-[(5-chloro-2-methylphenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 43386540 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-[(5-chloro-2-methylphenyl)carbamoyl]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H12ClNO3/c1-9-2-7-12(16)8-13(9)17-14(18)10-3-5-11(6-4-10)15(19)20/h2-8H,1H3,(H,17,18)(H,19,20) |
| InChIKey | NJKIATAQBRLYQP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |