C16H16N2O2S2 — CID 40599544
4-(1,3-dithiolan-2-yl)-N-(6-methoxy-3-pyridinyl)benzamide (PubChem CID 40599544) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-(6-methoxy-3-pyridinyl)benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-(6-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 40599544 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-(6-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C3SCCS3)cc2)cn1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-20-14-7-6-13(10-17-14)18-15(19)11-2-4-12(5-3-11)16-21-8-9-22-16/h2-7,10,16H,8-9H2,1H3,(H,18,19) |
| InChIKey | GCZGMRJOFVKFSH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |