3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid

C17H17NO5 — CID 769955

IUPAC3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid
SMILESCOc1cccc(OC)c1C(=O)Nc1cc(C(=O)O)ccc1C
InChIInChI=1S/C17H17NO5/c1-10-7-8-11(17(20)21)9-12(10)18-16(19)15-13(22-2)5-4-6-14(15)23-3/h4-9H,1-3H3,(H,18,19)(H,20,21)
InChIKeyKZLZIHWJIJSJJA-UHFFFAOYSA-N
MW315.33 g/mol
LogP2.96
Rot. Bonds5

About 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid

3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid (PubChem CID 769955) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid.

Molecular Properties

Compound Name3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid
PubChem CID769955
Molecular FormulaC17H17NO5
Molecular Weight315.33 g/mol
Exact Mass315.11
IUPAC Name3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid
SMILESCOc1cccc(OC)c1C(=O)Nc1cc(C(=O)O)ccc1C
InChIInChI=1S/C17H17NO5/c1-10-7-8-11(17(20)21)9-12(10)18-16(19)15-13(22-2)5-4-6-14(15)23-3/h4-9H,1-3H3,(H,18,19)(H,20,21)
InChIKeyKZLZIHWJIJSJJA-UHFFFAOYSA-N
XLogP2.96
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.33
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid?
The IUPAC name of 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid (CID 769955) is 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid.
What is the SMILES notation for 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid?
The canonical SMILES for 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid is COc1cccc(OC)c1C(=O)Nc1cc(C(=O)O)ccc1C.
What is the InChIKey of 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid?
The InChIKey is KZLZIHWJIJSJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5/c1-10-7-8-11(17(20)21)9-12(10)18-16(19)15-13(22-2)5-4-6-14(15)23-3/h4-9H,1-3H3,(H,18,19)(H,20,21).
What are the key properties of 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid?
3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid has a molecular weight of 315.33 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethoxybenzoyl)amino]-4-methylbenzoic acid is sourced from PubChem (CID 769955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).