C17H14F6N2O2 — CID 21364356
[5-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-methoxyphenyl]-methanidylazanium (PubChem CID 21364356) has the molecular formula C17H14F6N2O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is [5-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-methoxyphenyl]-methanidylazanium.
| Compound Name | [5-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-methoxyphenyl]-methanidylazanium |
|---|---|
| PubChem CID | 21364356 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [5-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-methoxyphenyl]-methanidylazanium |
| SMILES | [CH2-][NH2+]c1cc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1OC |
| InChI | InChI=1S/C17H14F6N2O2/c1-24-13-5-9(3-4-14(13)27-2)15(26)25-12-7-10(16(18,19)20)6-11(8-12)17(21,22)23/h3-8H,1,24H2,2H3,(H,25,26) |
| InChIKey | YJLHOGMLRZQOQA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|