C22H22F6N2O4S — CID 100795505
N-[3,5-bis(trifluoromethyl)phenyl]-3-(cyclohexylsulfamoyl)-4-methoxybenzamide (PubChem CID 100795505) has the molecular formula C22H22F6N2O4S and a molecular weight of 524.48 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-3-(cyclohexylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-(cyclohexylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 100795505 |
| Molecular Formula | C22H22F6N2O4S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-(cyclohexylsulfamoyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H22F6N2O4S/c1-34-18-8-7-13(9-19(18)35(32,33)30-16-5-3-2-4-6-16)20(31)29-17-11-14(21(23,24)25)10-15(12-17)22(26,27)28/h7-12,16,30H,2-6H2,1H3,(H,29,31) |
| InChIKey | AJBFJGUXKJIGLS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |