C24H29N3O6S — CID 42147015
3-(cyclopentylsulfamoyl)-4-methoxy-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 42147015) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-4-methoxy-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 42147015 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC3CCCC3)c2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C24H29N3O6S/c1-32-20-12-9-16(14-22(20)34(30,31)26-17-6-3-4-7-17)24(29)25-18-10-11-19(21(15-18)33-2)27-13-5-8-23(27)28/h9-12,14-15,17,26H,3-8,13H2,1-2H3,(H,25,29) |
| InChIKey | WWUDQXOFIHXBMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |