C21H22F2N2O6S — CID 38201593
methyl 5-[[3-(cyclopentylsulfamoyl)-4-methoxybenzoyl]amino]-2,4-difluorobenzoate (PubChem CID 38201593) has the molecular formula C21H22F2N2O6S and a molecular weight of 468.48 g/mol. Its IUPAC name is methyl 5-[[3-(cyclopentylsulfamoyl)-4-methoxybenzoyl]amino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[[3-(cyclopentylsulfamoyl)-4-methoxybenzoyl]amino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 38201593 |
| Molecular Formula | C21H22F2N2O6S |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | methyl 5-[[3-(cyclopentylsulfamoyl)-4-methoxybenzoyl]amino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC3CCCC3)c2)c(F)cc1F |
| InChI | InChI=1S/C21H22F2N2O6S/c1-30-18-8-7-12(9-19(18)32(28,29)25-13-5-3-4-6-13)20(26)24-17-10-14(21(27)31-2)15(22)11-16(17)23/h7-11,13,25H,3-6H2,1-2H3,(H,24,26) |
| InChIKey | BKEFURMTEXFXDY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |