C17H12ClF4NO3 — CID 56629235
ethyl 3-chloro-4-[[2-fluoro-3-(trifluoromethyl)benzoyl]amino]benzoate (PubChem CID 56629235) has the molecular formula C17H12ClF4NO3 and a molecular weight of 389.73 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[2-fluoro-3-(trifluoromethyl)benzoyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[2-fluoro-3-(trifluoromethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 56629235 |
| Molecular Formula | C17H12ClF4NO3 |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | ethyl 3-chloro-4-[[2-fluoro-3-(trifluoromethyl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(C(F)(F)F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C17H12ClF4NO3/c1-2-26-16(25)9-6-7-13(12(18)8-9)23-15(24)10-4-3-5-11(14(10)19)17(20,21)22/h3-8H,2H2,1H3,(H,23,24) |
| InChIKey | RGUGPWNAJLCEKW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |