C18H21ClN2OS — CID 119628946
N-(2-amino-2-methylpropyl)-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 119628946) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-(2-amino-2-methylpropyl)-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 119628946 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | CC(C)(N)CNC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H21ClN2OS/c1-18(2,20)12-21-17(22)14-5-3-13(4-6-14)11-23-16-9-7-15(19)8-10-16/h3-10H,11-12,20H2,1-2H3,(H,21,22) |
| InChIKey | GNBDMPNVCRUSRG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |