C19H15ClN2O2S2 — CID 4787365
2-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]thiophene-3-carboxamide (PubChem CID 4787365) has the molecular formula C19H15ClN2O2S2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4787365 |
| Molecular Formula | C19H15ClN2O2S2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S2/c20-14-5-7-15(8-6-14)26-11-12-1-3-13(4-2-12)18(24)22-19-16(17(21)23)9-10-25-19/h1-10H,11H2,(H2,21,23)(H,22,24) |
| InChIKey | IDNSOXGLORDWGC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |