C15H14N2O4S — CID 7996489
[4-[(3-carbamoylthiophen-2-yl)carbamoyl]phenyl]methyl acetate (PubChem CID 7996489) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is [4-[(3-carbamoylthiophen-2-yl)carbamoyl]phenyl]methyl acetate.
| Compound Name | [4-[(3-carbamoylthiophen-2-yl)carbamoyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 7996489 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [4-[(3-carbamoylthiophen-2-yl)carbamoyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(C(=O)Nc2sccc2C(N)=O)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-9(18)21-8-10-2-4-11(5-3-10)14(20)17-15-12(13(16)19)6-7-22-15/h2-7H,8H2,1H3,(H2,16,19)(H,17,20) |
| InChIKey | RRDFJXXJMUUIEW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |