C15H14F3N3O3 — CID 27813023
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide (PubChem CID 27813023) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 27813023 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
| SMILES | Cc1noc(C)c1CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H14F3N3O3/c1-7-9(8(2)24-21-7)5-12(22)19-6-13(23)20-11-4-3-10(16)14(17)15(11)18/h3-4H,5-6H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | AAMMYSZLHSIYGH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|