C20H20F3N3O6 — CID 26676496
3,4,5-trimethoxy-N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]benzamide (PubChem CID 26676496) has the molecular formula C20H20F3N3O6 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 26676496 |
| Molecular Formula | C20H20F3N3O6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C20H20F3N3O6/c1-30-13-6-10(7-14(31-2)19(13)32-3)20(29)25-8-15(27)24-9-16(28)26-12-5-4-11(21)17(22)18(12)23/h4-7H,8-9H2,1-3H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | LTONIIMUALIFJP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|