C20H19F3N2O4 — CID 27813309
3,4-dimethoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-5-prop-2-enylbenzamide (PubChem CID 27813309) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 27813309 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C20H19F3N2O4/c1-4-5-11-8-12(9-15(28-2)19(11)29-3)20(27)24-10-16(26)25-14-7-6-13(21)17(22)18(14)23/h4,6-9H,1,5,10H2,2-3H3,(H,24,27)(H,25,26) |
| InChIKey | HCUQINTZIJHAPD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|