C17H18BrN3O3S — CID 27781556
N-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 27781556) has the molecular formula C17H18BrN3O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is N-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 27781556 |
| Molecular Formula | C17H18BrN3O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H18BrN3O3S/c1-11-8-13(18)2-3-14(11)21-16(23)9-20-15(22)4-6-19-17(24)12-5-7-25-10-12/h2-3,5,7-8,10H,4,6,9H2,1H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | YGFLKFSLYFBQQX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |