C14H12O6S4 — CID 161144062
4-[1,2-bis(sulfanyl)-2-(4-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 161144062) has the molecular formula C14H12O6S4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[1,2-bis(sulfanyl)-2-(4-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 4-[1,2-bis(sulfanyl)-2-(4-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 161144062 |
| Molecular Formula | C14H12O6S4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 4-[1,2-bis(sulfanyl)-2-(4-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C(S)=C(S)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H12O6S4/c15-23(16,17)11-5-1-9(2-6-11)13(21)14(22)10-3-7-12(8-4-10)24(18,19)20/h1-8,21-22H,(H,15,16,17)(H,18,19,20) |
| InChIKey | RPRIXAOBIZREPK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|