C15H14O3S3 — CID 157366311
4-[2-(4-methylphenyl)-1,2-bis(sulfanyl)ethenyl]benzenesulfonic acid (PubChem CID 157366311) has the molecular formula C15H14O3S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)-1,2-bis(sulfanyl)ethenyl]benzenesulfonic acid.
| Compound Name | 4-[2-(4-methylphenyl)-1,2-bis(sulfanyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 157366311 |
| Molecular Formula | C15H14O3S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-[2-(4-methylphenyl)-1,2-bis(sulfanyl)ethenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(C(S)=C(S)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H14O3S3/c1-10-2-4-11(5-3-10)14(19)15(20)12-6-8-13(9-7-12)21(16,17)18/h2-9,19-20H,1H3,(H,16,17,18) |
| InChIKey | VIYLCZXCBVXMEQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|