C7H9N3O6S2 — CID 91010096
4-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid (PubChem CID 91010096) has the molecular formula C7H9N3O6S2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 4-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91010096 |
| Molecular Formula | C7H9N3O6S2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 4-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)C=NNNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H9N3O6S2/c11-17(12,13)5-8-10-9-6-1-3-7(4-2-6)18(14,15)16/h1-5,9-10H,(H,11,12,13)(H,14,15,16) |
| InChIKey | LWYCIQACGLRUGA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|