C9H12N4O7S2 — CID 90923415
4-acetamido-2-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid (PubChem CID 90923415) has the molecular formula C9H12N4O7S2 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-acetamido-2-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-acetamido-2-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90923415 |
| Molecular Formula | C9H12N4O7S2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 4-acetamido-2-[2-(sulfomethylideneamino)hydrazinyl]benzenesulfonic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)O)c(NNN=CS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H12N4O7S2/c1-6(14)11-7-2-3-9(22(18,19)20)8(4-7)12-13-10-5-21(15,16)17/h2-5,12-13H,1H3,(H,11,14)(H,15,16,17)(H,18,19,20) |
| InChIKey | JYLYOVNPKBXZEC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 174.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|