C11H10N2O4S — CID 145276006
5-amino-8-formamidonaphthalene-2-sulfonic acid (PubChem CID 145276006) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 5-amino-8-formamidonaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-8-formamidonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 145276006 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 5-amino-8-formamidonaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(NC=O)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C11H10N2O4S/c12-10-3-4-11(13-6-14)9-5-7(18(15,16)17)1-2-8(9)10/h1-6H,12H2,(H,13,14)(H,15,16,17) |
| InChIKey | DJUUTCZQZDJMSW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|