About 4-sulfobenzenediazonium bromide
4-sulfobenzenediazonium bromide (PubChem CID 11010880) has the molecular formula C6H5BrN2O3S
and a molecular weight of 265.09 g/mol. Its IUPAC name is 4-sulfobenzenediazonium bromide.
Molecular Properties
| Compound Name | 4-sulfobenzenediazonium bromide |
| PubChem CID | 11010880 |
| Molecular Formula | C6H5BrN2O3S |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | 4-sulfobenzenediazonium bromide |
| SMILES | N#[N+]c1ccc(S(=O)(=O)O)cc1.[Br-] |
| InChI | InChI=1S/C6H4N2O3S.BrH/c7-8-5-1-3-6(4-2-5)12(9,10)11;/h1-4H;1H |
| InChIKey | ANNYLNHZODDTGI-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfobenzenediazonium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfobenzenediazonium bromide?
The IUPAC name of 4-sulfobenzenediazonium bromide (CID 11010880) is 4-sulfobenzenediazonium bromide.
What is the SMILES notation for 4-sulfobenzenediazonium bromide?
The canonical SMILES for 4-sulfobenzenediazonium bromide is N#[N+]c1ccc(S(=O)(=O)O)cc1.[Br-].
What is the InChIKey of 4-sulfobenzenediazonium bromide?
The InChIKey is ANNYLNHZODDTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O3S.BrH/c7-8-5-1-3-6(4-2-5)12(9,10)11;/h1-4H;1H.
What are the key properties of 4-sulfobenzenediazonium bromide?
4-sulfobenzenediazonium bromide has a molecular weight of 265.09 g/mol, XLogP of -1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfobenzenediazonium bromide is sourced from PubChem (CID 11010880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).