About 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate
4-diazoniobenzenesulfonate;hydron;tetrafluoroborate (PubChem CID 170841623) has the molecular formula C6H5BF4N2O3S
and a molecular weight of 271.99 g/mol. Its IUPAC name is 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate.
Molecular Properties
| Compound Name | 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate |
| PubChem CID | 170841623 |
| Molecular Formula | C6H5BF4N2O3S |
| Molecular Weight | 271.99 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]c1ccc(S(=O)(=O)[O-])cc1.[H+] |
| InChI | InChI=1S/C6H4N2O3S.BF4/c7-8-5-1-3-6(4-2-5)12(9,10)11;2-1(3,4)5/h1-4H;/q;-1/p+1 |
| InChIKey | SYMLGWMCRULOOW-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.99 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate?
The IUPAC name of 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate (CID 170841623) is 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate.
What is the SMILES notation for 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate?
The canonical SMILES for 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate is F[B-](F)(F)F.N#[N+]c1ccc(S(=O)(=O)[O-])cc1.[H+].
What is the InChIKey of 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate?
The InChIKey is SYMLGWMCRULOOW-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4N2O3S.BF4/c7-8-5-1-3-6(4-2-5)12(9,10)11;2-1(3,4)5/h1-4H;/q;-1/p+1.
What are the key properties of 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate?
4-diazoniobenzenesulfonate;hydron;tetrafluoroborate has a molecular weight of 271.99 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazoniobenzenesulfonate;hydron;tetrafluoroborate is sourced from PubChem (CID 170841623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).