C56H29F10N5 — CID 137251512
2,3,4,5,6-pentafluoro-N-(2,3,4,5,6-pentafluorophenyl)-N-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]aniline (PubChem CID 137251512) has the molecular formula C56H29F10N5 and a molecular weight of 961.86 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2,3,4,5,6-pentafluorophenyl)-N-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2,3,4,5,6-pentafluorophenyl)-N-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 137251512 |
| Molecular Formula | C56H29F10N5 |
| Molecular Weight | 961.86 g/mol |
| Exact Mass | 961.23 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2,3,4,5,6-pentafluorophenyl)-N-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]aniline |
| SMILES | Fc1c(F)c(F)c(N(c2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C56H29F10N5/c57-45-47(59)51(63)55(52(64)48(45)60)71(56-53(65)49(61)46(58)50(62)54(56)66)32-18-16-31(17-19-32)44-39-26-24-37(69-39)42(29-12-6-2-7-13-29)35-22-20-33(67-35)41(28-10-4-1-5-11-28)34-21-23-36(68-34)43(30-14-8-3-9-15-30)38-25-27-40(44)70-38/h1-27,67,70H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | BHDOFMVVIQSNLS-LWQDQPMZSA-N |
| XLogP | 16.18 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.86 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|