C53H56N4O2Si — CID 136799178
2-trimethylsilylethyl 10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carboxylate (PubChem CID 136799178) has the molecular formula C53H56N4O2Si and a molecular weight of 809.14 g/mol. Its IUPAC name is 2-trimethylsilylethyl 10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carboxylate.
| Compound Name | 2-trimethylsilylethyl 10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carboxylate |
|---|---|
| PubChem CID | 136799178 |
| Molecular Formula | C53H56N4O2Si |
| Molecular Weight | 809.14 g/mol |
| Exact Mass | 808.42 |
| IUPAC Name | 2-trimethylsilylethyl 10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-carboxylate |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(C(=O)OCC[Si](C)(C)C)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C53H56N4O2Si/c1-29-23-32(4)46(33(5)24-29)49-38-13-15-40(54-38)50(47-34(6)25-30(2)26-35(47)7)42-17-19-44(56-42)52(53(58)59-21-22-60(10,11)12)45-20-18-43(57-45)51(41-16-14-39(49)55-41)48-36(8)27-31(3)28-37(48)9/h13-20,23-28,54,57H,21-22H2,1-12H3/b49-38+,49-39+,50-40+,50-42+,51-41+,51-43+,52-44+,52-45+ |
| InChIKey | LSOKCXJYCYRDDD-PPGRHYGISA-N |
| XLogP | 13.93 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.14 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|