C39H19F12N5 — CID 162648266
4-[5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline (PubChem CID 162648266) has the molecular formula C39H19F12N5 and a molecular weight of 785.59 g/mol. Its IUPAC name is 4-[5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline.
| Compound Name | 4-[5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162648266 |
| Molecular Formula | C39H19F12N5 |
| Molecular Weight | 785.59 g/mol |
| Exact Mass | 785.14 |
| IUPAC Name | 4-[5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]-2,3,5,6-tetrafluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1c(F)c(F)c(-c2c3ccc([nH]3)c(-c3c(F)c(F)cc(F)c3F)c3nc(c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C39H19F12N5/c1-56(2)39-37(50)35(48)30(36(49)38(39)51)27-23-9-7-21(54-23)25(28-31(44)13(40)11-14(41)32(28)45)19-5-3-17(52-19)18-4-6-20(53-18)26(22-8-10-24(27)55-22)29-33(46)15(42)12-16(43)34(29)47/h3-12,52,54-55H,1-2H3/b18-17-,25-19+,25-21+,26-20+,26-22+,27-23+,27-24+ |
| InChIKey | KETVULHTKYYQFN-OTRRKTFSSA-N |
| XLogP | 11.43 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.59 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|