C48H38N4 — CID 136830098
2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6(24),7,9,11,13,15,17,19-undecaene (PubChem CID 136830098) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6(24),7,9,11,13,15,17,19-undecaene.
| Compound Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6(24),7,9,11,13,15,17,19-undecaene |
|---|---|
| PubChem CID | 136830098 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6(24),7,9,11,13,15,17,19-undecaene |
| SMILES | Cc1ccc(-c2c3cc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc2C=C4)C=N3)cc1 |
| InChI | InChI=1S/C48H38N4/c1-29-5-13-33(14-6-29)45-37-27-44(49-28-37)48(36-19-11-32(4)12-20-36)43-26-25-42(52-43)47(35-17-9-31(3)10-18-35)41-24-23-40(51-41)46(39-22-21-38(45)50-39)34-15-7-30(2)8-16-34/h5-28,50-51H,1-4H3/b45-37+,45-38-,46-39-,46-40-,47-41-,47-42-,48-43-,48-44+ |
| InChIKey | KETQJEXWJXJFKW-BTANPNPPSA-N |
| XLogP | 12.74 |
| TPSA | 56.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |