C53H34N6 — CID 137136154
4-(15-benzo[b][1]benzazepin-11-yl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile (PubChem CID 137136154) has the molecular formula C53H34N6 and a molecular weight of 754.90 g/mol. Its IUPAC name is 4-(15-benzo[b][1]benzazepin-11-yl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile.
| Compound Name | 4-(15-benzo[b][1]benzazepin-11-yl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 137136154 |
| Molecular Formula | C53H34N6 |
| Molecular Weight | 754.90 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | 4-(15-benzo[b][1]benzazepin-11-yl-10,20-diphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(N4c5ccccc5C=Cc5ccccc54)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C53H34N6/c54-33-34-19-21-39(22-20-34)52-42-27-25-40(55-42)50(37-13-3-1-4-14-37)44-29-31-46(57-44)53(59-48-17-9-7-11-35(48)23-24-36-12-8-10-18-49(36)59)47-32-30-45(58-47)51(38-15-5-2-6-16-38)41-26-28-43(52)56-41/h1-32,55,58H/b50-40-,50-44-,51-41-,51-45-,52-42-,52-43-,53-46+,53-47+ |
| InChIKey | RCQKEHDRTYROIW-WYLMTPRLSA-N |
| XLogP | 13.48 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.90 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|