C25H15N2NaO4 — CID 59499550
sodium 3,5-bis[(4-ethynylbenzoyl)amino]benzoate (PubChem CID 59499550) has the molecular formula C25H15N2NaO4 and a molecular weight of 430.40 g/mol. Its IUPAC name is sodium 3,5-bis[(4-ethynylbenzoyl)amino]benzoate.
| Compound Name | sodium 3,5-bis[(4-ethynylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 59499550 |
| Molecular Formula | C25H15N2NaO4 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | sodium 3,5-bis[(4-ethynylbenzoyl)amino]benzoate |
| SMILES | C#Cc1ccc(C(=O)Nc2cc(NC(=O)c3ccc(C#C)cc3)cc(C(=O)[O-])c2)cc1.[Na+] |
| InChI | InChI=1S/C25H16N2O4.Na/c1-3-16-5-9-18(10-6-16)23(28)26-21-13-20(25(30)31)14-22(15-21)27-24(29)19-11-7-17(4-2)8-12-19;/h1-2,5-15H,(H,26,28)(H,27,29)(H,30,31);/q;+1/p-1 |
| InChIKey | LXBKEKPPMLCMKK-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|