C31H20N4O5 — CID 2260257
1-N,3-N-bis(3-ethynylphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide (PubChem CID 2260257) has the molecular formula C31H20N4O5 and a molecular weight of 528.52 g/mol. Its IUPAC name is 1-N,3-N-bis(3-ethynylphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-ethynylphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2260257 |
| Molecular Formula | C31H20N4O5 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-N,3-N-bis(3-ethynylphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc(C(=O)Nc3cccc(C#C)c3)c2)c1 |
| InChI | InChI=1S/C31H20N4O5/c1-3-20-7-5-9-25(15-20)32-30(37)23-17-24(31(38)33-26-10-6-8-21(4-2)16-26)19-27(18-23)34-29(36)22-11-13-28(14-12-22)35(39)40/h1-2,5-19H,(H,32,37)(H,33,38)(H,34,36) |
| InChIKey | LFWGOFZVXKAFRS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|