C13H8F3NO3S — CID 61234942
3-(thiophene-3-carbonylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 61234942) has the molecular formula C13H8F3NO3S and a molecular weight of 315.27 g/mol. Its IUPAC name is 3-(thiophene-3-carbonylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(thiophene-3-carbonylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 61234942 |
| Molecular Formula | C13H8F3NO3S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 3-(thiophene-3-carbonylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccsc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F3NO3S/c14-13(15,16)9-3-8(12(19)20)4-10(5-9)17-11(18)7-1-2-21-6-7/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | WRTHFIDCJYPZMR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |