C13H13F3N2O3 — CID 61235682
3-(pyrrolidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 61235682) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3-(pyrrolidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(pyrrolidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 61235682 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-(pyrrolidine-1-carbonylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)N2CCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-13(15,16)9-5-8(11(19)20)6-10(7-9)17-12(21)18-3-1-2-4-18/h5-7H,1-4H2,(H,17,21)(H,19,20) |
| InChIKey | QCRGLYUDUONSFX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |