C21H17NO6S — CID 2457012
methyl 2-[(2-methoxydibenzofuran-3-yl)sulfamoyl]benzoate (PubChem CID 2457012) has the molecular formula C21H17NO6S and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl 2-[(2-methoxydibenzofuran-3-yl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[(2-methoxydibenzofuran-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2457012 |
| Molecular Formula | C21H17NO6S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 2-[(2-methoxydibenzofuran-3-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)Nc1cc2oc3ccccc3c2cc1OC |
| InChI | InChI=1S/C21H17NO6S/c1-26-19-11-15-13-7-3-5-9-17(13)28-18(15)12-16(19)22-29(24,25)20-10-6-4-8-14(20)21(23)27-2/h3-12,22H,1-2H3 |
| InChIKey | OWNDYLKMFIYJQA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |