C28H24N2O5S — CID 3679313
N-(2-methoxydibenzofuran-3-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 3679313) has the molecular formula C28H24N2O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3679313 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1cc2c(cc1NC(=O)c1ccc(C)c(S(=O)(=O)Nc3ccc(C)cc3)c1)oc1ccccc12 |
| InChI | InChI=1S/C28H24N2O5S/c1-17-8-12-20(13-9-17)30-36(32,33)27-14-19(11-10-18(27)2)28(31)29-23-16-25-22(15-26(23)34-3)21-6-4-5-7-24(21)35-25/h4-16,30H,1-3H3,(H,29,31) |
| InChIKey | PRUOEELCFKAIPM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |