C27H22N2O5S — CID 26667364
N-(2-methoxydibenzofuran-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 26667364) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 26667364 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1cc2c(cc1NC(=O)c1ccc(S(=O)(=O)Nc3ccccc3C)cc1)oc1ccccc12 |
| InChI | InChI=1S/C27H22N2O5S/c1-17-7-3-5-9-22(17)29-35(31,32)19-13-11-18(12-14-19)27(30)28-23-16-25-21(15-26(23)33-2)20-8-4-6-10-24(20)34-25/h3-16,29H,1-2H3,(H,28,30) |
| InChIKey | LWJNDVWQJIXTEP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |