C19H17N3O4 — CID 31693977
2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 31693977) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 31693977 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[(2-methoxydibenzofuran-3-yl)amino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | COc1cc2c(cc1NCC(=O)Nc1cc(C)no1)oc1ccccc12 |
| InChI | InChI=1S/C19H17N3O4/c1-11-7-19(26-22-11)21-18(23)10-20-14-9-16-13(8-17(14)24-2)12-5-3-4-6-15(12)25-16/h3-9,20H,10H2,1-2H3,(H,21,23) |
| InChIKey | LZRVZFYKLIIENN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_A(4)', 'substructure': 'N/A'} |
|---|